C27H24N6O2S2 — CID 1136046
2-[[5-[(4-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 1136046) has the molecular formula C27H24N6O2S2 and a molecular weight of 528.66 g/mol. Its IUPAC name is 2-[[5-[(4-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[5-[(4-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 1136046 |
| Molecular Formula | C27H24N6O2S2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 2-[[5-[(4-methoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccc(NCc2nnc(SCC(=O)Nc3nc(-c4ccccc4)cs3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N6O2S2/c1-35-22-14-12-20(13-15-22)28-16-24-31-32-27(33(24)21-10-6-3-7-11-21)37-18-25(34)30-26-29-23(17-36-26)19-8-4-2-5-9-19/h2-15,17,28H,16,18H2,1H3,(H,29,30,34) |
| InChIKey | IETCNVRDGQZRCU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|