C16H21NO9 — CID 11360731
[(1R,2S,7R,8R,8aS)-1,2,8-triacetyloxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl] acetate (PubChem CID 11360731) has the molecular formula C16H21NO9 and a molecular weight of 371.34 g/mol. Its IUPAC name is [(1R,2S,7R,8R,8aS)-1,2,8-triacetyloxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl] acetate.
| Compound Name | [(1R,2S,7R,8R,8aS)-1,2,8-triacetyloxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl] acetate |
|---|---|
| PubChem CID | 11360731 |
| Molecular Formula | C16H21NO9 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [(1R,2S,7R,8R,8aS)-1,2,8-triacetyloxy-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@@H](OC(C)=O)[C@H](OC(C)=O)CC(=O)N2C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H21NO9/c1-7(18)23-11-5-13(22)17-6-12(24-8(2)19)16(26-10(4)21)14(17)15(11)25-9(3)20/h11-12,14-16H,5-6H2,1-4H3/t11-,12+,14+,15+,16+/m1/s1 |
| InChIKey | NKEMBNSJLBNDEB-MLEONAHRSA-N |
| XLogP | -0.67 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|