C17H19N5O3S — CID 11360802
1-(4-methylsulfonylphenyl)-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine (PubChem CID 11360802) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-(4-methylsulfonylphenyl)-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 11360802 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine |
| SMILES | CS(=O)(=O)c1ccc(-n2ncc3c(OC4CCNCC4)ncnc32)cc1 |
| InChI | InChI=1S/C17H19N5O3S/c1-26(23,24)14-4-2-12(3-5-14)22-16-15(10-21-22)17(20-11-19-16)25-13-6-8-18-9-7-13/h2-5,10-11,13,18H,6-9H2,1H3 |
| InChIKey | BUASULFPEGUFMH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |