C22H32O5 — CID 11360892
[(1S,2S,2'S,3S,4R,7S)-7-ethenyl-1-[(S)-hydroxy-[(1R)-2-oxocyclopentyl]methyl]-2'-methoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-yl] acetate (PubChem CID 11360892) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(1S,2S,2'S,3S,4R,7S)-7-ethenyl-1-[(S)-hydroxy-[(1R)-2-oxocyclopentyl]methyl]-2'-methoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-yl] acetate.
| Compound Name | [(1S,2S,2'S,3S,4R,7S)-7-ethenyl-1-[(S)-hydroxy-[(1R)-2-oxocyclopentyl]methyl]-2'-methoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-yl] acetate |
|---|---|
| PubChem CID | 11360892 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(1S,2S,2'S,3S,4R,7S)-7-ethenyl-1-[(S)-hydroxy-[(1R)-2-oxocyclopentyl]methyl]-2'-methoxyspiro[bicyclo[2.2.1]heptane-3,1'-cyclopentane]-2-yl] acetate |
| SMILES | C=C[C@H]1[C@H]2CC[C@]1([C@@H](O)[C@H]1CCCC1=O)[C@H](OC(C)=O)[C@@]21CCC[C@@H]1OC |
| InChI | InChI=1S/C22H32O5/c1-4-15-16-10-12-22(15,19(25)14-7-5-8-17(14)24)20(27-13(2)23)21(16)11-6-9-18(21)26-3/h4,14-16,18-20,25H,1,5-12H2,2-3H3/t14-,15-,16+,18-,19-,20+,21-,22-/m0/s1 |
| InChIKey | ZINKZJBBTPVVGH-ASCJQENTSA-N |
| XLogP | 3.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|