C21H32O6 — CID 11360995
(3aS,6aS,7aR)-3a-hydroxy-4-(2-hydroxyethoxy)-5,5-dimethyl-2,3-di(propan-2-yloxy)-6,6a,7,7a-tetrahydrocyclopenta[a]pentalen-1-one (PubChem CID 11360995) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (3aS,6aS,7aR)-3a-hydroxy-4-(2-hydroxyethoxy)-5,5-dimethyl-2,3-di(propan-2-yloxy)-6,6a,7,7a-tetrahydrocyclopenta[a]pentalen-1-one.
| Compound Name | (3aS,6aS,7aR)-3a-hydroxy-4-(2-hydroxyethoxy)-5,5-dimethyl-2,3-di(propan-2-yloxy)-6,6a,7,7a-tetrahydrocyclopenta[a]pentalen-1-one |
|---|---|
| PubChem CID | 11360995 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (3aS,6aS,7aR)-3a-hydroxy-4-(2-hydroxyethoxy)-5,5-dimethyl-2,3-di(propan-2-yloxy)-6,6a,7,7a-tetrahydrocyclopenta[a]pentalen-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)[C@@]2(O)C3=C(OCCO)C(C)(C)C[C@@H]3C[C@H]2C1=O |
| InChI | InChI=1S/C21H32O6/c1-11(2)26-17-16(23)14-9-13-10-20(5,6)18(25-8-7-22)15(13)21(14,24)19(17)27-12(3)4/h11-14,22,24H,7-10H2,1-6H3/t13-,14-,21-/m0/s1 |
| InChIKey | SIAXHCHIJMMWQI-RXSFTSLZSA-N |
| XLogP | 2.69 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |