C21H26N4O3 — CID 11361057
9-(1-methoxybutyl)-3-(4-methoxyphenyl)-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (PubChem CID 11361057) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 9-(1-methoxybutyl)-3-(4-methoxyphenyl)-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one.
| Compound Name | 9-(1-methoxybutyl)-3-(4-methoxyphenyl)-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
|---|---|
| PubChem CID | 11361057 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 9-(1-methoxybutyl)-3-(4-methoxyphenyl)-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| SMILES | CCCC(OC)N1CCn2c(=O)n(-c3ccc(OC)cc3)c3nc(C)cc1c32 |
| InChI | InChI=1S/C21H26N4O3/c1-5-6-18(28-4)23-11-12-24-19-17(23)13-14(2)22-20(19)25(21(24)26)15-7-9-16(27-3)10-8-15/h7-10,13,18H,5-6,11-12H2,1-4H3 |
| InChIKey | LGPJBFIUKQJUBB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |