C20H21N3O3S — CID 11361090
4-[5-methoxy-3-(1,2,3,6-tetrahydropyridin-4-yl)indol-1-yl]sulfonylaniline (PubChem CID 11361090) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[5-methoxy-3-(1,2,3,6-tetrahydropyridin-4-yl)indol-1-yl]sulfonylaniline.
| Compound Name | 4-[5-methoxy-3-(1,2,3,6-tetrahydropyridin-4-yl)indol-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 11361090 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-[5-methoxy-3-(1,2,3,6-tetrahydropyridin-4-yl)indol-1-yl]sulfonylaniline |
| SMILES | COc1ccc2c(c1)c(C1=CCNCC1)cn2S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-26-16-4-7-20-18(12-16)19(14-8-10-22-11-9-14)13-23(20)27(24,25)17-5-2-15(21)3-6-17/h2-8,12-13,22H,9-11,21H2,1H3 |
| InChIKey | FXJNMAADTCUZOE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|