C14H19IO5 — CID 11361397
(2R)-2-[(1E,3R,4R,6R,7Z)-3,4,6-trihydroxy-8-iodo-3-methylocta-1,7-dienyl]-2,3-dihydropyran-6-one (PubChem CID 11361397) has the molecular formula C14H19IO5 and a molecular weight of 394.21 g/mol. Its IUPAC name is (2R)-2-[(1E,3R,4R,6R,7Z)-3,4,6-trihydroxy-8-iodo-3-methylocta-1,7-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3R,4R,6R,7Z)-3,4,6-trihydroxy-8-iodo-3-methylocta-1,7-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11361397 |
| Molecular Formula | C14H19IO5 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | (2R)-2-[(1E,3R,4R,6R,7Z)-3,4,6-trihydroxy-8-iodo-3-methylocta-1,7-dienyl]-2,3-dihydropyran-6-one |
| SMILES | C[C@@](O)(/C=C/[C@H]1CC=CC(=O)O1)[C@H](O)C[C@@H](O)/C=C\I |
| InChI | InChI=1S/C14H19IO5/c1-14(19,12(17)9-10(16)6-8-15)7-5-11-3-2-4-13(18)20-11/h2,4-8,10-12,16-17,19H,3,9H2,1H3/b7-5+,8-6-/t10-,11+,12+,14+/m0/s1 |
| InChIKey | KKGGPQSVWMSEET-SDBXSACNSA-N |
| XLogP | 1.23 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|