C20H29NO7 — CID 11361432
tert-butyl 2-[(4S,5R)-5-[(4-methoxyphenyl)methoxymethoxymethyl]-2-oxo-1,3-oxazinan-4-yl]acetate (PubChem CID 11361432) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is tert-butyl 2-[(4S,5R)-5-[(4-methoxyphenyl)methoxymethoxymethyl]-2-oxo-1,3-oxazinan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4S,5R)-5-[(4-methoxyphenyl)methoxymethoxymethyl]-2-oxo-1,3-oxazinan-4-yl]acetate |
|---|---|
| PubChem CID | 11361432 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | tert-butyl 2-[(4S,5R)-5-[(4-methoxyphenyl)methoxymethoxymethyl]-2-oxo-1,3-oxazinan-4-yl]acetate |
| SMILES | COc1ccc(COCOC[C@@H]2COC(=O)N[C@H]2CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H29NO7/c1-20(2,3)28-18(22)9-17-15(12-27-19(23)21-17)11-26-13-25-10-14-5-7-16(24-4)8-6-14/h5-8,15,17H,9-13H2,1-4H3,(H,21,23)/t15-,17+/m1/s1 |
| InChIKey | IYQNBPNRLKQNMM-WBVHZDCISA-N |
| XLogP | 2.64 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|