About 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide
3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide (PubChem CID 11361526) has the molecular formula C12H26N6O3S3
and a molecular weight of 398.58 g/mol. Its IUPAC name is 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide.
Molecular Properties
| Compound Name | 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide |
| PubChem CID | 11361526 |
| Molecular Formula | C12H26N6O3S3 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide |
| SMILES | NNC(=O)CCSCC(CSCCC(=O)NN)SCCC(=O)NN |
| InChI | InChI=1S/C12H26N6O3S3/c13-16-10(19)1-4-22-7-9(24-6-3-12(21)18-15)8-23-5-2-11(20)17-14/h9H,1-8,13-15H2,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | WBGCOMPRNSJICN-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide?
The IUPAC name of 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide (CID 11361526) is 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide.
What is the SMILES notation for 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide?
The canonical SMILES for 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide is NNC(=O)CCSCC(CSCCC(=O)NN)SCCC(=O)NN.
What is the InChIKey of 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide?
The InChIKey is WBGCOMPRNSJICN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N6O3S3/c13-16-10(19)1-4-22-7-9(24-6-3-12(21)18-15)8-23-5-2-11(20)17-14/h9H,1-8,13-15H2,(H,16,19)(H,17,20)(H,18,21).
What are the key properties of 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide?
3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide has a molecular weight of 398.58 g/mol, XLogP of -1.31, 14 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-bis[(3-hydrazinyl-3-oxopropyl)sulfanyl]propylsulfanyl]propanehydrazide is sourced from PubChem (CID 11361526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).