About CID 11361554
CID 11361554 (PubChem CID 11361554) has the molecular formula C24H33NO4
and a molecular weight of 399.53 g/mol.
Molecular Properties
| Compound Name | CID 11361554 |
| PubChem CID | 11361554 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | — |
| SMILES | NCCOc1ccc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C24H33NO4/c25-9-10-26-22-3-1-18(2-4-22)19-5-7-23(8-6-19)27-24(29-28-23)20-12-16-11-17(14-20)15-21(24)13-16/h1-4,16-17,19-21H,5-15,25H2 |
| InChIKey | VMONZEUPUYQQHE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 11361554 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11361554?
The IUPAC name of CID 11361554 (CID 11361554) is not available.
What is the SMILES notation for CID 11361554?
The canonical SMILES for CID 11361554 is NCCOc1ccc(C2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1.
What is the InChIKey of CID 11361554?
The InChIKey is VMONZEUPUYQQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33NO4/c25-9-10-26-22-3-1-18(2-4-22)19-5-7-23(8-6-19)27-24(29-28-23)20-12-16-11-17(14-20)15-21(24)13-16/h1-4,16-17,19-21H,5-15,25H2.
What are the key properties of CID 11361554?
CID 11361554 has a molecular weight of 399.53 g/mol, XLogP of 4.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11361554 is sourced from PubChem (CID 11361554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).