C21H27N3O5 — CID 11361613
ethyl 5-(2-amino-5-methoxybenzoyl)-2-(cyclohexanecarbonyl)-3,4-dihydropyrazole-3-carboxylate (PubChem CID 11361613) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is ethyl 5-(2-amino-5-methoxybenzoyl)-2-(cyclohexanecarbonyl)-3,4-dihydropyrazole-3-carboxylate.
| Compound Name | ethyl 5-(2-amino-5-methoxybenzoyl)-2-(cyclohexanecarbonyl)-3,4-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 11361613 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | ethyl 5-(2-amino-5-methoxybenzoyl)-2-(cyclohexanecarbonyl)-3,4-dihydropyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1CC(C(=O)c2cc(OC)ccc2N)=NN1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C21H27N3O5/c1-3-29-21(27)18-12-17(19(25)15-11-14(28-2)9-10-16(15)22)23-24(18)20(26)13-7-5-4-6-8-13/h9-11,13,18H,3-8,12,22H2,1-2H3 |
| InChIKey | KIHJPWRGFKCGNF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|