C24H23N3OS — CID 11361630
(5S,7aR)-1-methyl-6-(4-methylphenyl)-5,7a-diphenyl-5,7-dihydroimidazo[1,5-b][1,2,4]oxadiazole-2-thione (PubChem CID 11361630) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is (5S,7aR)-1-methyl-6-(4-methylphenyl)-5,7a-diphenyl-5,7-dihydroimidazo[1,5-b][1,2,4]oxadiazole-2-thione.
| Compound Name | (5S,7aR)-1-methyl-6-(4-methylphenyl)-5,7a-diphenyl-5,7-dihydroimidazo[1,5-b][1,2,4]oxadiazole-2-thione |
|---|---|
| PubChem CID | 11361630 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (5S,7aR)-1-methyl-6-(4-methylphenyl)-5,7a-diphenyl-5,7-dihydroimidazo[1,5-b][1,2,4]oxadiazole-2-thione |
| SMILES | Cc1ccc(N2C[C@]3(c4ccccc4)N(C)C(=S)ON3[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3OS/c1-18-13-15-21(16-14-18)26-17-24(20-11-7-4-8-12-20)25(2)23(29)28-27(24)22(26)19-9-5-3-6-10-19/h3-16,22H,17H2,1-2H3/t22-,24-/m0/s1 |
| InChIKey | JSOAXESTIBGRBL-UPVQGACJSA-N |
| XLogP | 4.83 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|