C24H38O3Si — CID 11361669
[(2E,5E)-hepta-2,5-dien-4-yl]oxy-(1-phenylmethoxybut-3-en-2-yloxy)-di(propan-2-yl)silane (PubChem CID 11361669) has the molecular formula C24H38O3Si and a molecular weight of 402.65 g/mol. Its IUPAC name is [(2E,5E)-hepta-2,5-dien-4-yl]oxy-(1-phenylmethoxybut-3-en-2-yloxy)-di(propan-2-yl)silane.
| Compound Name | [(2E,5E)-hepta-2,5-dien-4-yl]oxy-(1-phenylmethoxybut-3-en-2-yloxy)-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 11361669 |
| Molecular Formula | C24H38O3Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | [(2E,5E)-hepta-2,5-dien-4-yl]oxy-(1-phenylmethoxybut-3-en-2-yloxy)-di(propan-2-yl)silane |
| SMILES | C=CC(COCc1ccccc1)O[Si](OC(/C=C/C)/C=C/C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H38O3Si/c1-8-14-24(15-9-2)27-28(20(4)5,21(6)7)26-23(10-3)19-25-18-22-16-12-11-13-17-22/h8-17,20-21,23-24H,3,18-19H2,1-2,4-7H3/b14-8+,15-9+ |
| InChIKey | ANWUQZLAPXCDJM-VOMDNODZSA-N |
| XLogP | 6.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|