C24H31N5O — CID 11361743
N-[1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-4-phenylbutanamide (PubChem CID 11361743) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is N-[1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-4-phenylbutanamide.
| Compound Name | N-[1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 11361743 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | N-[1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-4-phenylbutanamide |
| SMILES | Cc1ccccc1N/C(=N/C(NC(=O)CCCc1ccccc1)C(C)(C)C)NC#N |
| InChI | InChI=1S/C24H31N5O/c1-18-11-8-9-15-20(18)27-23(26-17-25)29-22(24(2,3)4)28-21(30)16-10-14-19-12-6-5-7-13-19/h5-9,11-13,15,22H,10,14,16H2,1-4H3,(H,28,30)(H2,26,27,29) |
| InChIKey | XXPHSXHVTAUNJP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|