C22H36O5Si — CID 11361835
dimethyl (3aS,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate (PubChem CID 11361835) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is dimethyl (3aS,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aS,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11361835 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | dimethyl (3aS,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-methyl-3,3a,6,7-tetrahydro-1H-azulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(C)C[C@H](CO[Si](C)(C)C(C)(C)C)C=C[C@@H]2C1 |
| InChI | InChI=1S/C22H36O5Si/c1-15-11-16(14-27-28(7,8)21(2,3)4)9-10-17-12-22(13-18(15)17,19(23)25-5)20(24)26-6/h9-10,16-17H,11-14H2,1-8H3/t16-,17-/m1/s1 |
| InChIKey | PZQHYYXQAAYNLH-IAGOWNOFSA-N |
| XLogP | 4.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|