C22H42O3Si2 — CID 11361896
(3R,6Z,12E,14E)-1,3-bis(trimethylsilyloxy)hexadeca-6,12,14-trien-8-one (PubChem CID 11361896) has the molecular formula C22H42O3Si2 and a molecular weight of 410.75 g/mol. Its IUPAC name is (3R,6Z,12E,14E)-1,3-bis(trimethylsilyloxy)hexadeca-6,12,14-trien-8-one.
| Compound Name | (3R,6Z,12E,14E)-1,3-bis(trimethylsilyloxy)hexadeca-6,12,14-trien-8-one |
|---|---|
| PubChem CID | 11361896 |
| Molecular Formula | C22H42O3Si2 |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | (3R,6Z,12E,14E)-1,3-bis(trimethylsilyloxy)hexadeca-6,12,14-trien-8-one |
| SMILES | C/C=C/C=C/CCCC(=O)/C=C\CC[C@H](CCO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H42O3Si2/c1-8-9-10-11-12-13-16-21(23)17-14-15-18-22(25-27(5,6)7)19-20-24-26(2,3)4/h8-11,14,17,22H,12-13,15-16,18-20H2,1-7H3/b9-8+,11-10+,17-14-/t22-/m1/s1 |
| InChIKey | GRYADSCKVANFIJ-HPFVZJGCSA-N |
| XLogP | 6.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|