C26H42O2Si — CID 11362003
(1R,4R,5S,7R,10S,11R,13S)-7-[tert-butyl(dimethyl)silyl]oxy-5,10,17-trimethylpentacyclo[11.2.2.01,11.04,10.05,7]heptadec-16-en-15-one (PubChem CID 11362003) has the molecular formula C26H42O2Si and a molecular weight of 414.71 g/mol. Its IUPAC name is (1R,4R,5S,7R,10S,11R,13S)-7-[tert-butyl(dimethyl)silyl]oxy-5,10,17-trimethylpentacyclo[11.2.2.01,11.04,10.05,7]heptadec-16-en-15-one.
| Compound Name | (1R,4R,5S,7R,10S,11R,13S)-7-[tert-butyl(dimethyl)silyl]oxy-5,10,17-trimethylpentacyclo[11.2.2.01,11.04,10.05,7]heptadec-16-en-15-one |
|---|---|
| PubChem CID | 11362003 |
| Molecular Formula | C26H42O2Si |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (1R,4R,5S,7R,10S,11R,13S)-7-[tert-butyl(dimethyl)silyl]oxy-5,10,17-trimethylpentacyclo[11.2.2.01,11.04,10.05,7]heptadec-16-en-15-one |
| SMILES | CC1=C[C@]23CC[C@@H]4[C@](C)(CC[C@@]5(O[Si](C)(C)C(C)(C)C)C[C@@]45C)[C@H]2C[C@H]1CC3=O |
| InChI | InChI=1S/C26H42O2Si/c1-17-15-25-10-9-19-23(5,20(25)13-18(17)14-21(25)27)11-12-26(16-24(19,26)6)28-29(7,8)22(2,3)4/h15,18-20H,9-14,16H2,1-8H3/t18-,19+,20+,23-,24-,25+,26+/m0/s1 |
| InChIKey | BMSCLQBHLIWWDM-PSGIFZTMSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|