C27H44O3 — CID 11362055
(4S,5S)-4-[[(1S,4S,6R)-4-ethenoxy-6-[(E)-oct-6-enyl]cyclohex-2-en-1-yl]methyl]-2,2-dimethyl-5-[(E)-pent-3-enyl]-1,3-dioxolane (PubChem CID 11362055) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is (4S,5S)-4-[[(1S,4S,6R)-4-ethenoxy-6-[(E)-oct-6-enyl]cyclohex-2-en-1-yl]methyl]-2,2-dimethyl-5-[(E)-pent-3-enyl]-1,3-dioxolane.
| Compound Name | (4S,5S)-4-[[(1S,4S,6R)-4-ethenoxy-6-[(E)-oct-6-enyl]cyclohex-2-en-1-yl]methyl]-2,2-dimethyl-5-[(E)-pent-3-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11362055 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | (4S,5S)-4-[[(1S,4S,6R)-4-ethenoxy-6-[(E)-oct-6-enyl]cyclohex-2-en-1-yl]methyl]-2,2-dimethyl-5-[(E)-pent-3-enyl]-1,3-dioxolane |
| SMILES | C=CO[C@@H]1C=C[C@@H](C[C@@H]2OC(C)(C)O[C@H]2CC/C=C/C)[C@H](CCCCC/C=C/C)C1 |
| InChI | InChI=1S/C27H44O3/c1-6-9-11-12-13-15-16-22-20-24(28-8-3)19-18-23(22)21-26-25(17-14-10-7-2)29-27(4,5)30-26/h6-10,18-19,22-26H,3,11-17,20-21H2,1-2,4-5H3/b9-6+,10-7+/t22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | JJXJJZFYYUDJPN-JZDTVVICSA-N |
| XLogP | 7.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|