C22H21N9O — CID 11362353
2-(furan-2-yl)-5-[4-(quinolin-3-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 11362353) has the molecular formula C22H21N9O and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-(quinolin-3-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[4-(quinolin-3-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 11362353 |
| Molecular Formula | C22H21N9O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-(quinolin-3-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CCN(Cc3cnc4ccccc4c3)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C22H21N9O/c23-20-26-21(27-22-25-19(28-31(20)22)18-6-3-11-32-18)30-9-7-29(8-10-30)14-15-12-16-4-1-2-5-17(16)24-13-15/h1-6,11-13H,7-10,14H2,(H2,23,25,26,27,28) |
| InChIKey | XYTFWOCEJXZMBY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |