C25H33NO3S — CID 11362365
1-[3-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-methoxy-1-benzothiophen-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 11362365) has the molecular formula C25H33NO3S and a molecular weight of 427.61 g/mol. Its IUPAC name is 1-[3-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-methoxy-1-benzothiophen-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[3-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-methoxy-1-benzothiophen-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 11362365 |
| Molecular Formula | C25H33NO3S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1-[3-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-methoxy-1-benzothiophen-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc2sc(C(=O)C(C)(C)C)c(CC(=O)N3CC[C@@H]4CCCC[C@H]4C3)c2c1 |
| InChI | InChI=1S/C25H33NO3S/c1-25(2,3)24(28)23-20(19-13-18(29-4)9-10-21(19)30-23)14-22(27)26-12-11-16-7-5-6-8-17(16)15-26/h9-10,13,16-17H,5-8,11-12,14-15H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | VRZYMALVFMXNIY-IRXDYDNUSA-N |
| XLogP | 5.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |