C20H22FN5O3S — CID 11362457
4-N-(2,2-dimethoxyethyl)-2-N-(3-fluorophenyl)-6-(4-methoxyphenyl)sulfanyl-1,3,5-triazine-2,4-diamine (PubChem CID 11362457) has the molecular formula C20H22FN5O3S and a molecular weight of 431.49 g/mol. Its IUPAC name is 4-N-(2,2-dimethoxyethyl)-2-N-(3-fluorophenyl)-6-(4-methoxyphenyl)sulfanyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(2,2-dimethoxyethyl)-2-N-(3-fluorophenyl)-6-(4-methoxyphenyl)sulfanyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11362457 |
| Molecular Formula | C20H22FN5O3S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-N-(2,2-dimethoxyethyl)-2-N-(3-fluorophenyl)-6-(4-methoxyphenyl)sulfanyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Sc2nc(NCC(OC)OC)nc(Nc3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C20H22FN5O3S/c1-27-15-7-9-16(10-8-15)30-20-25-18(22-12-17(28-2)29-3)24-19(26-20)23-14-6-4-5-13(21)11-14/h4-11,17H,12H2,1-3H3,(H2,22,23,24,25,26) |
| InChIKey | DSUCPWUKPQLLCH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|