C21H40O7Si — CID 11362502
methyl 2-[(2S,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-[(2S,3S)-3-methoxy-4-oxobutan-2-yl]-5-methyloxan-2-yl]acetate (PubChem CID 11362502) has the molecular formula C21H40O7Si and a molecular weight of 432.63 g/mol. Its IUPAC name is methyl 2-[(2S,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-[(2S,3S)-3-methoxy-4-oxobutan-2-yl]-5-methyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-[(2S,3S)-3-methoxy-4-oxobutan-2-yl]-5-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 11362502 |
| Molecular Formula | C21H40O7Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | methyl 2-[(2S,4S,5S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-6-[(2S,3S)-3-methoxy-4-oxobutan-2-yl]-5-methyloxan-2-yl]acetate |
| SMILES | COC(=O)C[C@]1(OC)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H]([C@H](C)[C@@H](C=O)OC)O1 |
| InChI | InChI=1S/C21H40O7Si/c1-14-16(28-29(9,10)20(3,4)5)11-21(26-8,12-18(23)25-7)27-19(14)15(2)17(13-22)24-6/h13-17,19H,11-12H2,1-10H3/t14-,15-,16+,17-,19-,21+/m1/s1 |
| InChIKey | DWMSUYFPHDFUEF-QILZMWCDSA-N |
| XLogP | 3.56 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|