About 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine
4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine (PubChem CID 1136274) has the molecular formula C16H17Cl2N3OS
and a molecular weight of 370.31 g/mol. Its IUPAC name is 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine.
Molecular Properties
| Compound Name | 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine |
| PubChem CID | 1136274 |
| Molecular Formula | C16H17Cl2N3OS |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine |
| SMILES | Cc1cc(N2CCOCC2)nc(SCc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C16H17Cl2N3OS/c1-11-9-15(21-5-7-22-8-6-21)20-16(19-11)23-10-12-13(17)3-2-4-14(12)18/h2-4,9H,5-8,10H2,1H3 |
| InChIKey | WYCRDHRMIQNYRB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine?
The IUPAC name of 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine (CID 1136274) is 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine.
What is the SMILES notation for 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine?
The canonical SMILES for 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine is Cc1cc(N2CCOCC2)nc(SCc2c(Cl)cccc2Cl)n1.
What is the InChIKey of 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine?
The InChIKey is WYCRDHRMIQNYRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2N3OS/c1-11-9-15(21-5-7-22-8-6-21)20-16(19-11)23-10-12-13(17)3-2-4-14(12)18/h2-4,9H,5-8,10H2,1H3.
What are the key properties of 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine?
4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine has a molecular weight of 370.31 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(2,6-dichlorophenyl)methylsulfanyl]-6-methylpyrimidin-4-yl]morpholine is sourced from PubChem (CID 1136274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).