C22H20FNO6S — CID 11362809
(E)-3-ethoxycarbonyl-6-[5-fluoro-2-[(4-methylphenyl)sulfonylamino]phenyl]hex-3-en-5-ynoic acid (PubChem CID 11362809) has the molecular formula C22H20FNO6S and a molecular weight of 445.47 g/mol. Its IUPAC name is (E)-3-ethoxycarbonyl-6-[5-fluoro-2-[(4-methylphenyl)sulfonylamino]phenyl]hex-3-en-5-ynoic acid.
| Compound Name | (E)-3-ethoxycarbonyl-6-[5-fluoro-2-[(4-methylphenyl)sulfonylamino]phenyl]hex-3-en-5-ynoic acid |
|---|---|
| PubChem CID | 11362809 |
| Molecular Formula | C22H20FNO6S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (E)-3-ethoxycarbonyl-6-[5-fluoro-2-[(4-methylphenyl)sulfonylamino]phenyl]hex-3-en-5-ynoic acid |
| SMILES | CCOC(=O)/C(=C/C#Cc1cc(F)ccc1NS(=O)(=O)c1ccc(C)cc1)CC(=O)O |
| InChI | InChI=1S/C22H20FNO6S/c1-3-30-22(27)17(14-21(25)26)6-4-5-16-13-18(23)9-12-20(16)24-31(28,29)19-10-7-15(2)8-11-19/h6-13,24H,3,14H2,1-2H3,(H,25,26)/b17-6+ |
| InChIKey | IBQBUPNGVBHCHZ-UBKPWBPPSA-N |
| XLogP | 3.25 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|