C19H27FN2O5S2 — CID 11362836
2-[2-[(4S)-4-[(E,3R)-8-fluoro-3-hydroxy-4,4-dimethyloct-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 11362836) has the molecular formula C19H27FN2O5S2 and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-[2-[(4S)-4-[(E,3R)-8-fluoro-3-hydroxy-4,4-dimethyloct-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(4S)-4-[(E,3R)-8-fluoro-3-hydroxy-4,4-dimethyloct-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11362836 |
| Molecular Formula | C19H27FN2O5S2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-[2-[(4S)-4-[(E,3R)-8-fluoro-3-hydroxy-4,4-dimethyloct-1-enyl]-2-oxo-1,3-oxazolidin-3-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(CCCCF)[C@H](O)/C=C/[C@H]1COC(=O)N1CCSc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C19H27FN2O5S2/c1-19(2,7-3-4-8-20)15(23)6-5-13-11-27-18(26)22(13)9-10-28-17-21-14(12-29-17)16(24)25/h5-6,12-13,15,23H,3-4,7-11H2,1-2H3,(H,24,25)/b6-5+/t13-,15+/m0/s1 |
| InChIKey | WYMHORLLZUTSGD-XPKDBEDXSA-N |
| XLogP | 3.84 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|