C14H20FNO3P+ — CID 11362892
(4aR,8aS)-5-benzyl-2-fluoro-5-methyl-4,4a,6,7,8,8a-hexahydro-[1,3,2]dioxaphosphinino[5,4-b]pyridin-5-ium 2-oxide (PubChem CID 11362892) has the molecular formula C14H20FNO3P+ and a molecular weight of 300.29 g/mol. Its IUPAC name is (4aR,8aS)-5-benzyl-2-fluoro-5-methyl-4,4a,6,7,8,8a-hexahydro-[1,3,2]dioxaphosphinino[5,4-b]pyridin-5-ium 2-oxide.
| Compound Name | (4aR,8aS)-5-benzyl-2-fluoro-5-methyl-4,4a,6,7,8,8a-hexahydro-[1,3,2]dioxaphosphinino[5,4-b]pyridin-5-ium 2-oxide |
|---|---|
| PubChem CID | 11362892 |
| Molecular Formula | C14H20FNO3P+ |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (4aR,8aS)-5-benzyl-2-fluoro-5-methyl-4,4a,6,7,8,8a-hexahydro-[1,3,2]dioxaphosphinino[5,4-b]pyridin-5-ium 2-oxide |
| SMILES | C[N+]1(Cc2ccccc2)CCC[C@@H]2OP(=O)(F)OC[C@H]21 |
| InChI | InChI=1S/C14H20FNO3P/c1-16(10-12-6-3-2-4-7-12)9-5-8-14-13(16)11-18-20(15,17)19-14/h2-4,6-7,13-14H,5,8-11H2,1H3/q+1/t13-,14+,16?,20?/m1/s1 |
| InChIKey | GPBQULBOJOGOJK-DBTHTNCCSA-N |
| XLogP | 3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|