About 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one
2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 1136292) has the molecular formula C22H18N2O4S2
and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 1136292 |
| Molecular Formula | C22H18N2O4S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1C[C@H](O)CN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C22H18N2O4S2/c25-15(14-24-22(26)16-7-1-6-12-21(16)30(24,27)28)13-23-17-8-2-4-10-19(17)29-20-11-5-3-9-18(20)23/h1-12,15,25H,13-14H2/t15-/m1/s1 |
| InChIKey | IMNYVCDBGTXLAY-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one (CID 1136292) is 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one is O=C1c2ccccc2S(=O)(=O)N1C[C@H](O)CN1c2ccccc2Sc2ccccc21.
What is the InChIKey of 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is IMNYVCDBGTXLAY-OAHLLOKOSA-N. The full InChI is InChI=1S/C22H18N2O4S2/c25-15(14-24-22(26)16-7-1-6-12-21(16)30(24,27)28)13-23-17-8-2-4-10-19(17)29-20-11-5-3-9-18(20)23/h1-12,15,25H,13-14H2/t15-/m1/s1.
What are the key properties of 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one?
2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 438.53 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-2-hydroxy-3-phenothiazin-10-ylpropyl]-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 1136292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).