C30H31NO3 — CID 11363001
3-[(3R)-3-cyclohexyl-3-phenylpropanoyl]-4,4-diphenyl-1,3-oxazolidin-2-one (PubChem CID 11363001) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is 3-[(3R)-3-cyclohexyl-3-phenylpropanoyl]-4,4-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3R)-3-cyclohexyl-3-phenylpropanoyl]-4,4-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11363001 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 3-[(3R)-3-cyclohexyl-3-phenylpropanoyl]-4,4-diphenyl-1,3-oxazolidin-2-one |
| SMILES | O=C(C[C@@H](c1ccccc1)C1CCCCC1)N1C(=O)OCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31NO3/c32-28(21-27(23-13-5-1-6-14-23)24-15-7-2-8-16-24)31-29(33)34-22-30(31,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1,3-6,9-14,17-20,24,27H,2,7-8,15-16,21-22H2/t27-/m0/s1 |
| InChIKey | POZRREIPOCILCS-MHZLTWQESA-N |
| XLogP | 6.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |