About [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate
[(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate (PubChem CID 11363018) has the molecular formula C20H24NO2S2+
and a molecular weight of 374.55 g/mol. Its IUPAC name is [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate.
Molecular Properties
| Compound Name | [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate |
| PubChem CID | 11363018 |
| Molecular Formula | C20H24NO2S2+ |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate |
| SMILES | C=CC[N+]12CCC(CC1)[C@@H](OC(=O)C(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C20H24NO2S2/c1-2-9-21-10-7-15(8-11-21)16(14-21)23-20(22)19(17-5-3-12-24-17)18-6-4-13-25-18/h2-6,12-13,15-16,19H,1,7-11,14H2/q+1/t15?,16-,21?/m0/s1 |
| InChIKey | JHZYHMVHIVLEHC-TZQQIIETSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate?
The IUPAC name of [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate (CID 11363018) is [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate.
What is the SMILES notation for [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate?
The canonical SMILES for [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate is C=CC[N+]12CCC(CC1)[C@@H](OC(=O)C(c1cccs1)c1cccs1)C2.
What is the InChIKey of [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate?
The InChIKey is JHZYHMVHIVLEHC-TZQQIIETSA-N. The full InChI is InChI=1S/C20H24NO2S2/c1-2-9-21-10-7-15(8-11-21)16(14-21)23-20(22)19(17-5-3-12-24-17)18-6-4-13-25-18/h2-6,12-13,15-16,19H,1,7-11,14H2/q+1/t15?,16-,21?/m0/s1.
What are the key properties of [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate?
[(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate has a molecular weight of 374.55 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2,2-dithiophen-2-ylacetate is sourced from PubChem (CID 11363018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).