C24H31NO2S2Si — CID 11363098
(2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-methyl-3-(4-methylphenyl)-3-trimethylsilyloxypropan-1-one (PubChem CID 11363098) has the molecular formula C24H31NO2S2Si and a molecular weight of 457.74 g/mol. Its IUPAC name is (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-methyl-3-(4-methylphenyl)-3-trimethylsilyloxypropan-1-one.
| Compound Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-methyl-3-(4-methylphenyl)-3-trimethylsilyloxypropan-1-one |
|---|---|
| PubChem CID | 11363098 |
| Molecular Formula | C24H31NO2S2Si |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (2S,3R)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-methyl-3-(4-methylphenyl)-3-trimethylsilyloxypropan-1-one |
| SMILES | Cc1ccc([C@H](O[Si](C)(C)C)[C@H](C)C(=O)N2C(=S)SC[C@@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO2S2Si/c1-17-11-13-20(14-12-17)22(27-30(3,4)5)18(2)23(26)25-21(16-29-24(25)28)15-19-9-7-6-8-10-19/h6-14,18,21-22H,15-16H2,1-5H3/t18-,21-,22+/m0/s1 |
| InChIKey | SKNYSSZBKRRGRF-YUXAGFNASA-N |
| XLogP | 6.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|