C24H37N5O4 — CID 11363138
(2S,3S)-5-[2-(5-aminopentylamino)-2-oxoethyl]-N-hydroxy-2-(3-phenylpyrrolidine-1-carbonyl)piperidine-3-carboxamide (PubChem CID 11363138) has the molecular formula C24H37N5O4 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2S,3S)-5-[2-(5-aminopentylamino)-2-oxoethyl]-N-hydroxy-2-(3-phenylpyrrolidine-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | (2S,3S)-5-[2-(5-aminopentylamino)-2-oxoethyl]-N-hydroxy-2-(3-phenylpyrrolidine-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11363138 |
| Molecular Formula | C24H37N5O4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | (2S,3S)-5-[2-(5-aminopentylamino)-2-oxoethyl]-N-hydroxy-2-(3-phenylpyrrolidine-1-carbonyl)piperidine-3-carboxamide |
| SMILES | NCCCCCNC(=O)CC1CN[C@H](C(=O)N2CCC(c3ccccc3)C2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C24H37N5O4/c25-10-5-2-6-11-26-21(30)14-17-13-20(23(31)28-33)22(27-15-17)24(32)29-12-9-19(16-29)18-7-3-1-4-8-18/h1,3-4,7-8,17,19-20,22,27,33H,2,5-6,9-16,25H2,(H,26,30)(H,28,31)/t17?,19?,20-,22-/m0/s1 |
| InChIKey | VXPAAABROXRBQT-XHXISMBCSA-N |
| XLogP | 0.74 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|