C27H36N4O3 — CID 11363270
(2S)-2-[(1-aminocyclohexanecarbonyl)amino]-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide (PubChem CID 11363270) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is (2S)-2-[(1-aminocyclohexanecarbonyl)amino]-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide.
| Compound Name | (2S)-2-[(1-aminocyclohexanecarbonyl)amino]-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide |
|---|---|
| PubChem CID | 11363270 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | (2S)-2-[(1-aminocyclohexanecarbonyl)amino]-N-[(2S)-2-(naphthalen-1-ylmethyl)pent-4-enyl]butanediamide |
| SMILES | C=CC[C@H](CNC(=O)[C@H](CC(N)=O)NC(=O)C1(N)CCCCC1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C27H36N4O3/c1-2-9-19(16-21-12-8-11-20-10-4-5-13-22(20)21)18-30-25(33)23(17-24(28)32)31-26(34)27(29)14-6-3-7-15-27/h2,4-5,8,10-13,19,23H,1,3,6-7,9,14-18,29H2,(H2,28,32)(H,30,33)(H,31,34)/t19-,23-/m0/s1 |
| InChIKey | CFHZPJNOMHXQHC-CVDCTZTESA-N |
| XLogP | 2.71 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|