C18H18ClF5N6O — CID 11363276
5-chloro-6-[4-[2-(dimethylamino)ethoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 11363276) has the molecular formula C18H18ClF5N6O and a molecular weight of 464.83 g/mol. Its IUPAC name is 5-chloro-6-[4-[2-(dimethylamino)ethoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-[4-[2-(dimethylamino)ethoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11363276 |
| Molecular Formula | C18H18ClF5N6O |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 5-chloro-6-[4-[2-(dimethylamino)ethoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCN(C)C)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C18H18ClF5N6O/c1-9(18(22,23)24)27-16-14(15(19)28-17-25-8-26-30(16)17)13-11(20)6-10(7-12(13)21)31-5-4-29(2)3/h6-9,27H,4-5H2,1-3H3/t9-/m0/s1 |
| InChIKey | FDKOUKLCYAUQES-VIFPVBQESA-N |
| XLogP | 4.03 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |