C24H28F2N6O2 — CID 11363397
1-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 11363397) has the molecular formula C24H28F2N6O2 and a molecular weight of 470.52 g/mol. Its IUPAC name is 1-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 11363397 |
| Molecular Formula | C24H28F2N6O2 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-[2-[2-[1-[2-(2,4-difluorophenyl)oxiran-2-yl]ethyl]tetrazol-5-yl]ethyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(CCc2nnn(C(C)C3(c4ccc(F)cc4F)CO3)n2)CC1 |
| InChI | InChI=1S/C24H28F2N6O2/c1-17(24(16-34-24)19-8-7-18(25)15-20(19)26)32-28-23(27-29-32)9-10-30-11-13-31(14-12-30)21-5-3-4-6-22(21)33-2/h3-8,15,17H,9-14,16H2,1-2H3 |
| InChIKey | GVQZVSNWEMQCKY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|