C16H16Cl2O8S2 — CID 11363417
(15S,16S)-15,16-dimethyl-1,8-dithioniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene diperchlorate (PubChem CID 11363417) has the molecular formula C16H16Cl2O8S2 and a molecular weight of 471.34 g/mol. Its IUPAC name is (15S,16S)-15,16-dimethyl-1,8-dithioniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene diperchlorate.
| Compound Name | (15S,16S)-15,16-dimethyl-1,8-dithioniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene diperchlorate |
|---|---|
| PubChem CID | 11363417 |
| Molecular Formula | C16H16Cl2O8S2 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 469.97 |
| IUPAC Name | (15S,16S)-15,16-dimethyl-1,8-dithioniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene diperchlorate |
| SMILES | C[C@H]1[C@H](C)[S+]2c3ccccc3[S+]1c1ccccc12.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H16S2.2ClHO4/c1-11-12(2)18-15-9-5-3-7-13(15)17(11)14-8-4-6-10-16(14)18;2*2-1(3,4)5/h3-12H,1-2H3;2*(H,2,3,4,5)/q+2;;/p-2/t11-,12-,17?,18?;;/m0../s1 |
| InChIKey | BHZJFQHKLPGBLH-XYNPWTRASA-L |
| XLogP | -5.65 |
| TPSA | 184.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|