About 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide (PubChem CID 11363465) has the molecular formula C21H17ClN4O3S2
and a molecular weight of 472.98 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide.
Molecular Properties
| Compound Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide |
| PubChem CID | 11363465 |
| Molecular Formula | C21H17ClN4O3S2 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc(Cl)cc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C21H17ClN4O3S2/c1-26(13-14-6-3-2-4-7-14)21(27)16-11-10-15(22)12-18(16)25-31(28,29)19-9-5-8-17-20(19)24-30-23-17/h2-12,25H,13H2,1H3 |
| InChIKey | JMMVFKHCJVTTMG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide?
The IUPAC name of 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide (CID 11363465) is 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide.
What is the SMILES notation for 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide?
The canonical SMILES for 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide is CN(Cc1ccccc1)C(=O)c1ccc(Cl)cc1NS(=O)(=O)c1cccc2nsnc12.
What is the InChIKey of 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide?
The InChIKey is JMMVFKHCJVTTMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN4O3S2/c1-26(13-14-6-3-2-4-7-14)21(27)16-11-10-15(22)12-18(16)25-31(28,29)19-9-5-8-17-20(19)24-30-23-17/h2-12,25H,13H2,1H3.
What are the key properties of 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide?
2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide has a molecular weight of 472.98 g/mol, XLogP of 4.42, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)-N-benzyl-4-chloro-N-methylbenzamide is sourced from PubChem (CID 11363465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).