C25H32ClN3O2S — CID 11363487
1-[(3aS,6R,7aS)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-ethylthiourea;hydrochloride (PubChem CID 11363487) has the molecular formula C25H32ClN3O2S and a molecular weight of 474.07 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-ethylthiourea;hydrochloride.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-ethylthiourea;hydrochloride |
|---|---|
| PubChem CID | 11363487 |
| Molecular Formula | C25H32ClN3O2S |
| Molecular Weight | 474.07 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(1,3-benzodioxol-5-yl)-1-benzyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-ethylthiourea;hydrochloride |
| SMILES | CCNC(=S)N[C@@H]1CC[C@@]2(c3ccc4c(c3)OCO4)CCN(Cc3ccccc3)[C@H]2C1.Cl |
| InChI | InChI=1S/C25H31N3O2S.ClH/c1-2-26-24(31)27-20-10-11-25(19-8-9-21-22(14-19)30-17-29-21)12-13-28(23(25)15-20)16-18-6-4-3-5-7-18;/h3-9,14,20,23H,2,10-13,15-17H2,1H3,(H2,26,27,31);1H/t20-,23+,25+;/m1./s1 |
| InChIKey | VSZUNAUXXHMUPK-QXMJGDHLSA-N |
| XLogP | 4.39 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|