C24H22ClN5O4 — CID 11363623
N'-(5-chloro-2-pyridinyl)-N-[(1R,2S)-2-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]cyclopentyl]oxamide (PubChem CID 11363623) has the molecular formula C24H22ClN5O4 and a molecular weight of 479.92 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[(1R,2S)-2-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]cyclopentyl]oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[(1R,2S)-2-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]cyclopentyl]oxamide |
|---|---|
| PubChem CID | 11363623 |
| Molecular Formula | C24H22ClN5O4 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[(1R,2S)-2-[[4-(2-oxo-1-pyridinyl)benzoyl]amino]cyclopentyl]oxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C(=O)N[C@@H]1CCC[C@@H]1NC(=O)c1ccc(-n2ccccc2=O)cc1 |
| InChI | InChI=1S/C24H22ClN5O4/c25-16-9-12-20(26-14-16)29-24(34)23(33)28-19-5-3-4-18(19)27-22(32)15-7-10-17(11-8-15)30-13-2-1-6-21(30)31/h1-2,6-14,18-19H,3-5H2,(H,27,32)(H,28,33)(H,26,29,34)/t18-,19+/m0/s1 |
| InChIKey | LKJFWNGTBPRWIS-RBUKOAKNSA-N |
| XLogP | 2.29 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|