C31H30O5 — CID 11363677
[(4R,5R)-5-[hydroperoxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanol (PubChem CID 11363677) has the molecular formula C31H30O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is [(4R,5R)-5-[hydroperoxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanol.
| Compound Name | [(4R,5R)-5-[hydroperoxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 11363677 |
| Molecular Formula | C31H30O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | [(4R,5R)-5-[hydroperoxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanol |
| SMILES | CC1(C)O[C@@H](C(O)(c2ccccc2)c2ccccc2)[C@H](C(OO)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C31H30O5/c1-29(2)34-27(30(32,23-15-7-3-8-16-23)24-17-9-4-10-18-24)28(35-29)31(36-33,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27-28,32-33H,1-2H3/t27-,28-/m1/s1 |
| InChIKey | PZQAFTPHLUVABV-VSGBNLITSA-N |
| XLogP | 5.88 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|