C26H50O4Si2 — CID 11363689
(Z)-3-[(2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-methyloxan-2-yl]-2-methylprop-2-enal (PubChem CID 11363689) has the molecular formula C26H50O4Si2 and a molecular weight of 482.85 g/mol. Its IUPAC name is (Z)-3-[(2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-methyloxan-2-yl]-2-methylprop-2-enal.
| Compound Name | (Z)-3-[(2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-methyloxan-2-yl]-2-methylprop-2-enal |
|---|---|
| PubChem CID | 11363689 |
| Molecular Formula | C26H50O4Si2 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | (Z)-3-[(2S,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-3-methyloxan-2-yl]-2-methylprop-2-enal |
| SMILES | C/C(C=O)=C/[C@@H]1O[C@H](C/C=C/CO[Si](C)(C)C(C)(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C26H50O4Si2/c1-20(19-27)17-23-21(2)24(30-32(11,12)26(6,7)8)18-22(29-23)15-13-14-16-28-31(9,10)25(3,4)5/h13-14,17,19,21-24H,15-16,18H2,1-12H3/b14-13+,20-17-/t21-,22-,23+,24-/m1/s1 |
| InChIKey | DHTJMDOTVQBIHE-PPGFQUDXSA-N |
| XLogP | 7.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|