C32H47NO4 — CID 11364225
10-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 1-O-methyl decanedioate (PubChem CID 11364225) has the molecular formula C32H47NO4 and a molecular weight of 509.73 g/mol. Its IUPAC name is 10-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 1-O-methyl decanedioate.
| Compound Name | 10-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 1-O-methyl decanedioate |
|---|---|
| PubChem CID | 11364225 |
| Molecular Formula | C32H47NO4 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.35 |
| IUPAC Name | 10-O-[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] 1-O-methyl decanedioate |
| SMILES | COC(=O)CCCCCCCCC(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C32H47NO4/c1-36-30(34)14-6-4-2-3-5-7-15-31(35)37-26-17-16-25-21-29-27-13-8-9-18-32(27,28(25)22-26)19-20-33(29)23-24-11-10-12-24/h16-17,22,24,27,29H,2-15,18-21,23H2,1H3/t27-,29+,32+/m0/s1 |
| InChIKey | BHKXQYNUEGAIAZ-RTKAOUNRSA-N |
| XLogP | 6.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|