C12H23BrHgO4 — CID 11364251
bromo-[(2R,3S,4S)-5-(2,2-dimethylpropanoyloxy)-3-hydroxy-2-(hydroxymethyl)-4-methylpentyl]mercury (PubChem CID 11364251) has the molecular formula C12H23BrHgO4 and a molecular weight of 511.81 g/mol. Its IUPAC name is bromo-[(2R,3S,4S)-5-(2,2-dimethylpropanoyloxy)-3-hydroxy-2-(hydroxymethyl)-4-methylpentyl]mercury.
| Compound Name | bromo-[(2R,3S,4S)-5-(2,2-dimethylpropanoyloxy)-3-hydroxy-2-(hydroxymethyl)-4-methylpentyl]mercury |
|---|---|
| PubChem CID | 11364251 |
| Molecular Formula | C12H23BrHgO4 |
| Molecular Weight | 511.81 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | bromo-[(2R,3S,4S)-5-(2,2-dimethylpropanoyloxy)-3-hydroxy-2-(hydroxymethyl)-4-methylpentyl]mercury |
| SMILES | C[C@@H](COC(=O)C(C)(C)C)[C@H](O)[C@@H](CO)C[Hg]Br |
| InChI | InChI=1S/C12H23O4.BrH.Hg/c1-8(6-13)10(14)9(2)7-16-11(15)12(3,4)5;;/h8-10,13-14H,1,6-7H2,2-5H3;1H;/q;;+1/p-1/t8-,9+,10-;;/m1../s1 |
| InChIKey | KQVDOKVPBMXGHM-FNNANFCNSA-M |
| XLogP | 1.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|