C33H56O3Si — CID 11364540
(3E,7E,11S,12E,15R,16S,17S,20R)-4,8,12,17-tetramethyl-11-tri(propan-2-yl)silyloxy-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-trien-21-one (PubChem CID 11364540) has the molecular formula C33H56O3Si and a molecular weight of 528.89 g/mol. Its IUPAC name is (3E,7E,11S,12E,15R,16S,17S,20R)-4,8,12,17-tetramethyl-11-tri(propan-2-yl)silyloxy-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-trien-21-one.
| Compound Name | (3E,7E,11S,12E,15R,16S,17S,20R)-4,8,12,17-tetramethyl-11-tri(propan-2-yl)silyloxy-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-trien-21-one |
|---|---|
| PubChem CID | 11364540 |
| Molecular Formula | C33H56O3Si |
| Molecular Weight | 528.89 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | (3E,7E,11S,12E,15R,16S,17S,20R)-4,8,12,17-tetramethyl-11-tri(propan-2-yl)silyloxy-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-trien-21-one |
| SMILES | C/C1=C\CC2C(=O)[C@@H]3OC[C@@H](C)[C@@H]3[C@H]2C/C=C(\C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C33H56O3Si/c1-21(2)37(22(3)4,23(5)6)36-30-19-15-25(8)13-11-12-24(7)14-17-29-28(18-16-26(30)9)31-27(10)20-35-33(31)32(29)34/h13-14,16,21-23,27-31,33H,11-12,15,17-20H2,1-10H3/b24-14+,25-13+,26-16+/t27-,28+,29?,30+,31-,33-/m1/s1 |
| InChIKey | YOWQDPXOTRXKEZ-ZAZHUQSFSA-N |
| XLogP | 9.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.89 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|