C33H42F2N2O3 — CID 11364901
1-[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]methanamine (PubChem CID 11364901) has the molecular formula C33H42F2N2O3 and a molecular weight of 552.71 g/mol. Its IUPAC name is 1-[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]methanamine.
| Compound Name | 1-[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 11364901 |
| Molecular Formula | C33H42F2N2O3 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 1-[1-[6,6-bis(4-fluorophenyl)hexyl]pyrrolidin-3-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]methanamine |
| SMILES | COc1cc(CNCC2CCN(CCCCCC(c3ccc(F)cc3)c3ccc(F)cc3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C33H42F2N2O3/c1-38-31-19-25(20-32(39-2)33(31)40-3)22-36-21-24-16-18-37(23-24)17-6-4-5-7-30(26-8-12-28(34)13-9-26)27-10-14-29(35)15-11-27/h8-15,19-20,24,30,36H,4-7,16-18,21-23H2,1-3H3 |
| InChIKey | YHGLBPUDIFJMHI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|