C32H38O6SSi — CID 11365233
[(2R,4aR,6S,7R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 11365233) has the molecular formula C32H38O6SSi and a molecular weight of 578.80 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 11365233 |
| Molecular Formula | C32H38O6SSi |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@H](Sc2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C32H38O6SSi/c1-32(2,3)40(4,5)38-27-26-25(21-34-30(37-26)23-17-11-7-12-18-23)35-31(39-24-19-13-8-14-20-24)28(27)36-29(33)22-15-9-6-10-16-22/h6-20,25-28,30-31H,21H2,1-5H3/t25-,26-,27+,28-,30-,31+/m1/s1 |
| InChIKey | VOTYGDXECYRZIF-BAZFVZDQSA-N |
| XLogP | 7.23 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|