C37H43ClO5 — CID 11365453
[(4aS,6aS,12aS,12bS)-11-chloro-4,4,6a,12b-tetramethyl-9,10-bis(phenylmethoxy)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-12-yl] acetate (PubChem CID 11365453) has the molecular formula C37H43ClO5 and a molecular weight of 603.20 g/mol. Its IUPAC name is [(4aS,6aS,12aS,12bS)-11-chloro-4,4,6a,12b-tetramethyl-9,10-bis(phenylmethoxy)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-12-yl] acetate.
| Compound Name | [(4aS,6aS,12aS,12bS)-11-chloro-4,4,6a,12b-tetramethyl-9,10-bis(phenylmethoxy)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-12-yl] acetate |
|---|---|
| PubChem CID | 11365453 |
| Molecular Formula | C37H43ClO5 |
| Molecular Weight | 603.20 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | [(4aS,6aS,12aS,12bS)-11-chloro-4,4,6a,12b-tetramethyl-9,10-bis(phenylmethoxy)-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthen-12-yl] acetate |
| SMILES | CC(=O)OC1c2c(cc(OCc3ccccc3)c(OCc3ccccc3)c2Cl)O[C@@]2(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C37H43ClO5/c1-24(39)42-33-30-27(43-37(5)20-17-29-35(2,3)18-12-19-36(29,4)34(33)37)21-28(40-22-25-13-8-6-9-14-25)32(31(30)38)41-23-26-15-10-7-11-16-26/h6-11,13-16,21,29,33-34H,12,17-20,22-23H2,1-5H3/t29-,33?,34+,36-,37-/m0/s1 |
| InChIKey | BEAOMJOFFJVDFZ-YKFJRGGZSA-N |
| XLogP | 9.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.20 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |