C28H22Cl3NO8 — CID 11365485
[(3R,4S,5R)-4,5-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate (PubChem CID 11365485) has the molecular formula C28H22Cl3NO8 and a molecular weight of 606.84 g/mol. Its IUPAC name is [(3R,4S,5R)-4,5-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate.
| Compound Name | [(3R,4S,5R)-4,5-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11365485 |
| Molecular Formula | C28H22Cl3NO8 |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 605.04 |
| IUPAC Name | [(3R,4S,5R)-4,5-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
| SMILES | [H]/N=C(/OC1OCC(OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C28H22Cl3NO8/c29-28(30,31)27(32)40-26-22(39-25(35)19-14-8-3-9-15-19)21(38-24(34)18-12-6-2-7-13-18)20(16-36-26)37-23(33)17-10-4-1-5-11-17/h1-15,20-22,26,32H,16H2/b32-27+/t20?,21-,22+,26?/m0/s1 |
| InChIKey | CTJJXLYHZINRRA-KBCYBPJGSA-N |
| XLogP | 5.38 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|