C35H42N2O8 — CID 11365562
[3-[[methyl-[7-[[(2Z)-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]heptyl]amino]methyl]phenyl] N-methylcarbamate (PubChem CID 11365562) has the molecular formula C35H42N2O8 and a molecular weight of 618.73 g/mol. Its IUPAC name is [3-[[methyl-[7-[[(2Z)-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]heptyl]amino]methyl]phenyl] N-methylcarbamate.
| Compound Name | [3-[[methyl-[7-[[(2Z)-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]heptyl]amino]methyl]phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 11365562 |
| Molecular Formula | C35H42N2O8 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | [3-[[methyl-[7-[[(2Z)-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]heptyl]amino]methyl]phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc(CN(C)CCCCCCCOc2ccc3c(c2)O/C(=C\c2cc(OC)c(OC)c(OC)c2)C3=O)c1 |
| InChI | InChI=1S/C35H42N2O8/c1-36-35(39)44-27-13-11-12-24(18-27)23-37(2)16-9-7-6-8-10-17-43-26-14-15-28-29(22-26)45-30(33(28)38)19-25-20-31(40-3)34(42-5)32(21-25)41-4/h11-15,18-22H,6-10,16-17,23H2,1-5H3,(H,36,39)/b30-19- |
| InChIKey | FIGDFKBRWHQHDX-FSGOGVSDSA-N |
| XLogP | 6.51 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|