C19H21N5O2 — CID 1136561
N-(2,6-dimethylphenyl)-2-[5-(4-ethoxyphenyl)tetrazol-2-yl]acetamide (PubChem CID 1136561) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[5-(4-ethoxyphenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[5-(4-ethoxyphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 1136561 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[5-(4-ethoxyphenyl)tetrazol-2-yl]acetamide |
| SMILES | CCOc1ccc(-c2nnn(CC(=O)Nc3c(C)cccc3C)n2)cc1 |
| InChI | InChI=1S/C19H21N5O2/c1-4-26-16-10-8-15(9-11-16)19-21-23-24(22-19)12-17(25)20-18-13(2)6-5-7-14(18)3/h5-11H,4,12H2,1-3H3,(H,20,25) |
| InChIKey | ZZCRDWQFVHBRDZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |